C25H31ClN4O5S — CID 171667855
N-[3-(diethylamino)propyl]-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide;hydrochloride (PubChem CID 171667855) has the molecular formula C25H31ClN4O5S and a molecular weight of 535.07 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[3-(diethylamino)propyl]-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 171667855 |
| Molecular Formula | C25H31ClN4O5S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | N-[3-(diethylamino)propyl]-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide;hydrochloride |
| SMILES | CCN(CC)CCCN(C(=O)c1cccc([N+](=O)[O-])c1)c1nc(-c2cc(OC)ccc2OC)cs1.Cl |
| InChI | InChI=1S/C25H30N4O5S.ClH/c1-5-27(6-2)13-8-14-28(24(30)18-9-7-10-19(15-18)29(31)32)25-26-22(17-35-25)21-16-20(33-3)11-12-23(21)34-4;/h7,9-12,15-17H,5-6,8,13-14H2,1-4H3;1H |
| InChIKey | QXSXAXWVZRSREZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|