C18H25Cl2N3O3S — CID 171700082
2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-[3-(dimethylamino)propyl]acetamide;hydrochloride (PubChem CID 171700082) has the molecular formula C18H25Cl2N3O3S and a molecular weight of 434.39 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-[3-(dimethylamino)propyl]acetamide;hydrochloride.
| Compound Name | 2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-[3-(dimethylamino)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 171700082 |
| Molecular Formula | C18H25Cl2N3O3S |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-[3-(dimethylamino)propyl]acetamide;hydrochloride |
| SMILES | COc1ccc(OC)c(-c2csc(N(CCCN(C)C)C(=O)CCl)n2)c1.Cl |
| InChI | InChI=1S/C18H24ClN3O3S.ClH/c1-21(2)8-5-9-22(17(23)11-19)18-20-15(12-26-18)14-10-13(24-3)6-7-16(14)25-4;/h6-7,10,12H,5,8-9,11H2,1-4H3;1H |
| InChIKey | RNRGASZOYIBELT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|