C15H17N3S — CID 61336305
4-[2-(3-aminopentan-3-yl)-1,3-thiazol-4-yl]benzonitrile (PubChem CID 61336305) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 4-[2-(3-aminopentan-3-yl)-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-(3-aminopentan-3-yl)-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 61336305 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-[2-(3-aminopentan-3-yl)-1,3-thiazol-4-yl]benzonitrile |
| SMILES | CCC(N)(CC)c1nc(-c2ccc(C#N)cc2)cs1 |
| InChI | InChI=1S/C15H17N3S/c1-3-15(17,4-2)14-18-13(10-19-14)12-7-5-11(9-16)6-8-12/h5-8,10H,3-4,17H2,1-2H3 |
| InChIKey | RTMATLIGCYEXOO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |