C21H12N2O2S — CID 155556116
3,6-bis(1-benzofuran-2-yl)imidazo[2,1-b][1,3]thiazole (PubChem CID 155556116) has the molecular formula C21H12N2O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is 3,6-bis(1-benzofuran-2-yl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 3,6-bis(1-benzofuran-2-yl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 155556116 |
| Molecular Formula | C21H12N2O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3,6-bis(1-benzofuran-2-yl)imidazo[2,1-b][1,3]thiazole |
| SMILES | c1ccc2oc(-c3cn4c(-c5cc6ccccc6o5)csc4n3)cc2c1 |
| InChI | InChI=1S/C21H12N2O2S/c1-3-7-17-13(5-1)9-19(24-17)15-11-23-16(12-26-21(23)22-15)20-10-14-6-2-4-8-18(14)25-20/h1-12H |
| InChIKey | ILAHKUJGQYYICE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 43.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |