C16H8N2O2S — CID 164723780
2-(furan-2-yl)-4-(3-isocyano-1-benzofuran-2-yl)-1,3-thiazole (PubChem CID 164723780) has the molecular formula C16H8N2O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-(3-isocyano-1-benzofuran-2-yl)-1,3-thiazole.
| Compound Name | 2-(furan-2-yl)-4-(3-isocyano-1-benzofuran-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 164723780 |
| Molecular Formula | C16H8N2O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-(furan-2-yl)-4-(3-isocyano-1-benzofuran-2-yl)-1,3-thiazole |
| SMILES | [C-]#[N+]c1c(-c2csc(-c3ccco3)n2)oc2ccccc12 |
| InChI | InChI=1S/C16H8N2O2S/c1-17-14-10-5-2-3-6-12(10)20-15(14)11-9-21-16(18-11)13-7-4-8-19-13/h2-9H |
| InChIKey | SMMJYIVIERFQAG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 43.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|