C9H9N3O2S — CID 839872
4-(2-hydrazinyl-1,3-thiazol-4-yl)benzene-1,2-diol (PubChem CID 839872) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is 4-(2-hydrazinyl-1,3-thiazol-4-yl)benzene-1,2-diol.
| Compound Name | 4-(2-hydrazinyl-1,3-thiazol-4-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 839872 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 4-(2-hydrazinyl-1,3-thiazol-4-yl)benzene-1,2-diol |
| SMILES | NNc1nc(-c2ccc(O)c(O)c2)cs1 |
| InChI | InChI=1S/C9H9N3O2S/c10-12-9-11-6(4-15-9)5-1-2-7(13)8(14)3-5/h1-4,13-14H,10H2,(H,11,12) |
| InChIKey | QXRBRUTXADCWTH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|