C10H11N3OS — CID 7172164
4-(2-hydrazinyl-1,3-thiazol-4-yl)-2-methylphenol (PubChem CID 7172164) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 4-(2-hydrazinyl-1,3-thiazol-4-yl)-2-methylphenol.
| Compound Name | 4-(2-hydrazinyl-1,3-thiazol-4-yl)-2-methylphenol |
|---|---|
| PubChem CID | 7172164 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4-(2-hydrazinyl-1,3-thiazol-4-yl)-2-methylphenol |
| SMILES | Cc1cc(-c2csc(NN)n2)ccc1O |
| InChI | InChI=1S/C10H11N3OS/c1-6-4-7(2-3-9(6)14)8-5-15-10(12-8)13-11/h2-5,14H,11H2,1H3,(H,12,13) |
| InChIKey | KFZWQAMSKRVALK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|