C8H9N3S2 — CID 63991302
[4-(3-methylthiophen-2-yl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 63991302) has the molecular formula C8H9N3S2 and a molecular weight of 211.32 g/mol. Its IUPAC name is [4-(3-methylthiophen-2-yl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-(3-methylthiophen-2-yl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 63991302 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | [4-(3-methylthiophen-2-yl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1ccsc1-c1csc(NN)n1 |
| InChI | InChI=1S/C8H9N3S2/c1-5-2-3-12-7(5)6-4-13-8(10-6)11-9/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | BCDBNPWFYXDKSW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|