C11H13N3S — CID 7174047
[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 7174047) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is [4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 7174047 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | [4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1ccc(-c2csc(NN)n2)cc1C |
| InChI | InChI=1S/C11H13N3S/c1-7-3-4-9(5-8(7)2)10-6-15-11(13-10)14-12/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | YIBBWRJJRPKZOL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|