C8H10N4S2 — CID 7174025
[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 7174025) has the molecular formula C8H10N4S2 and a molecular weight of 226.33 g/mol. Its IUPAC name is [4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 7174025 |
| Molecular Formula | C8H10N4S2 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | [4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1nc(C)c(-c2csc(NN)n2)s1 |
| InChI | InChI=1S/C8H10N4S2/c1-4-7(14-5(2)10-4)6-3-13-8(11-6)12-9/h3H,9H2,1-2H3,(H,11,12) |
| InChIKey | FJOFQMXZAIFLLD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|