C11H10N4O2S — CID 116967996
6-(2-hydrazinyl-1,3-thiazol-4-yl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116967996) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is 6-(2-hydrazinyl-1,3-thiazol-4-yl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(2-hydrazinyl-1,3-thiazol-4-yl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116967996 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 6-(2-hydrazinyl-1,3-thiazol-4-yl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(-c3csc(NN)n3)ccc21 |
| InChI | InChI=1S/C11H10N4O2S/c1-15-8-3-2-6(4-9(8)17-11(15)16)7-5-18-10(13-7)14-12/h2-5H,12H2,1H3,(H,13,14) |
| InChIKey | MIHWJVKBFUIREE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|