C13H16N2O3S — CID 67214469
2,6-dimethoxy-4-[2-(methylaminomethyl)-1,3-thiazol-4-yl]phenol (PubChem CID 67214469) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[2-(methylaminomethyl)-1,3-thiazol-4-yl]phenol.
| Compound Name | 2,6-dimethoxy-4-[2-(methylaminomethyl)-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 67214469 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2,6-dimethoxy-4-[2-(methylaminomethyl)-1,3-thiazol-4-yl]phenol |
| SMILES | CNCc1nc(-c2cc(OC)c(O)c(OC)c2)cs1 |
| InChI | InChI=1S/C13H16N2O3S/c1-14-6-12-15-9(7-19-12)8-4-10(17-2)13(16)11(5-8)18-3/h4-5,7,14,16H,6H2,1-3H3 |
| InChIKey | QDNWNVYPLJXGHG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |