C13H16N2O2S2 — CID 62652676
1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]propan-2-amine (PubChem CID 62652676) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]propan-2-amine.
| Compound Name | 1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 62652676 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]propan-2-amine |
| SMILES | CC(N)Cc1nc(-c2ccc(S(C)(=O)=O)cc2)cs1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-9(14)7-13-15-12(8-18-13)10-3-5-11(6-4-10)19(2,16)17/h3-6,8-9H,7,14H2,1-2H3 |
| InChIKey | WVXDVIHAOZQNTB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |