About 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole
2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole (PubChem CID 89426358) has the molecular formula C21H22BrNO2S2
and a molecular weight of 464.45 g/mol. Its IUPAC name is 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole |
| PubChem CID | 89426358 |
| Molecular Formula | C21H22BrNO2S2 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole |
| SMILES | Cc1cc(Cc2nc(-c3ccc(S(C)(=O)=O)cc3)cs2)c(C)cc1CCBr |
| InChI | InChI=1S/C21H22BrNO2S2/c1-14-11-18(15(2)10-17(14)8-9-22)12-21-23-20(13-26-21)16-4-6-19(7-5-16)27(3,24)25/h4-7,10-11,13H,8-9,12H2,1-3H3 |
| InChIKey | MBVWGWZMJVIHMW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole?
The IUPAC name of 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole (CID 89426358) is 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole.
What is the SMILES notation for 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole?
The canonical SMILES for 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole is Cc1cc(Cc2nc(-c3ccc(S(C)(=O)=O)cc3)cs2)c(C)cc1CCBr.
What is the InChIKey of 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole?
The InChIKey is MBVWGWZMJVIHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22BrNO2S2/c1-14-11-18(15(2)10-17(14)8-9-22)12-21-23-20(13-26-21)16-4-6-19(7-5-16)27(3,24)25/h4-7,10-11,13H,8-9,12H2,1-3H3.
What are the key properties of 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole?
2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole has a molecular weight of 464.45 g/mol, XLogP of 5.36, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(2-bromoethyl)-2,5-dimethylphenyl]methyl]-4-(4-methylsulfonylphenyl)-1,3-thiazole is sourced from PubChem (CID 89426358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).