C34H39ClN2O3S — CID 161140306
1-(4-tert-butylphenyl)-2-chloroethanone;4-(4-tert-butylphenyl)-2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazole (PubChem CID 161140306) has the molecular formula C34H39ClN2O3S and a molecular weight of 591.22 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-chloroethanone;4-(4-tert-butylphenyl)-2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazole.
| Compound Name | 1-(4-tert-butylphenyl)-2-chloroethanone;4-(4-tert-butylphenyl)-2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 161140306 |
| Molecular Formula | C34H39ClN2O3S |
| Molecular Weight | 591.22 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-chloroethanone;4-(4-tert-butylphenyl)-2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazole |
| SMILES | CC(C)(C)c1ccc(C(=O)CCl)cc1.Cc1cc([N+](=O)[O-])c(C)cc1Cc1nc(-c2ccc(C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C22H24N2O2S.C12H15ClO/c1-14-11-20(24(25)26)15(2)10-17(14)12-21-23-19(13-27-21)16-6-8-18(9-7-16)22(3,4)5;1-12(2,3)10-6-4-9(5-7-10)11(14)8-13/h6-11,13H,12H2,1-5H3;4-7H,8H2,1-3H3 |
| InChIKey | UNIVQLMXHJRKIC-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.22 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|