C18H17N3O3 — CID 145045117
5-[(2,5-dimethyl-4-nitrophenyl)methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 145045117) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-[(2,5-dimethyl-4-nitrophenyl)methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(2,5-dimethyl-4-nitrophenyl)methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 145045117 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-[(2,5-dimethyl-4-nitrophenyl)methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2noc(Cc3cc(C)c([N+](=O)[O-])cc3C)n2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-11-4-6-14(7-5-11)18-19-17(24-20-18)10-15-8-13(3)16(21(22)23)9-12(15)2/h4-9H,10H2,1-3H3 |
| InChIKey | MLEFCPIRLTWANG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|