C27H32N4O6S2 — CID 157190950
2-(2,5-dimethyl-4-nitrophenyl)ethanethioamide;propan-2-yl 2-[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]acetate (PubChem CID 157190950) has the molecular formula C27H32N4O6S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 2-(2,5-dimethyl-4-nitrophenyl)ethanethioamide;propan-2-yl 2-[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-(2,5-dimethyl-4-nitrophenyl)ethanethioamide;propan-2-yl 2-[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 157190950 |
| Molecular Formula | C27H32N4O6S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 2-(2,5-dimethyl-4-nitrophenyl)ethanethioamide;propan-2-yl 2-[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1CC(N)=S.Cc1cc([N+](=O)[O-])c(C)cc1Cc1nc(CC(=O)OC(C)C)cs1 |
| InChI | InChI=1S/C17H20N2O4S.C10H12N2O2S/c1-10(2)23-17(20)8-14-9-24-16(18-14)7-13-5-12(4)15(19(21)22)6-11(13)3;1-6-4-9(12(13)14)7(2)3-8(6)5-10(11)15/h5-6,9-10H,7-8H2,1-4H3;3-4H,5H2,1-2H3,(H2,11,15) |
| InChIKey | APRNFICJULFFFL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|