C28H30N4O7S2 — CID 158950943
[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]methanol;[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]methyl acetate (PubChem CID 158950943) has the molecular formula C28H30N4O7S2 and a molecular weight of 598.70 g/mol. Its IUPAC name is [2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]methanol;[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]methyl acetate.
| Compound Name | [2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]methanol;[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 158950943 |
| Molecular Formula | C28H30N4O7S2 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | [2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]methanol;[2-[(2,5-dimethyl-4-nitrophenyl)methyl]-1,3-thiazol-4-yl]methyl acetate |
| SMILES | CC(=O)OCc1csc(Cc2cc(C)c([N+](=O)[O-])cc2C)n1.Cc1cc([N+](=O)[O-])c(C)cc1Cc1nc(CO)cs1 |
| InChI | InChI=1S/C15H16N2O4S.C13H14N2O3S/c1-9-5-14(17(19)20)10(2)4-12(9)6-15-16-13(8-22-15)7-21-11(3)18;1-8-4-12(15(17)18)9(2)3-10(8)5-13-14-11(6-16)7-19-13/h4-5,8H,6-7H2,1-3H3;3-4,7,16H,5-6H2,1-2H3 |
| InChIKey | JLKMTHWBEMLELY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 158.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|