C20H16ClN3O5S — CID 30043959
[2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 5-chloro-2-nitrobenzoate (PubChem CID 30043959) has the molecular formula C20H16ClN3O5S and a molecular weight of 445.88 g/mol. Its IUPAC name is [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 5-chloro-2-nitrobenzoate.
| Compound Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 30043959 |
| Molecular Formula | C20H16ClN3O5S |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 5-chloro-2-nitrobenzoate |
| SMILES | Cc1ccc(NC(=O)Cc2nc(COC(=O)c3cc(Cl)ccc3[N+](=O)[O-])cs2)cc1 |
| InChI | InChI=1S/C20H16ClN3O5S/c1-12-2-5-14(6-3-12)22-18(25)9-19-23-15(11-30-19)10-29-20(26)16-8-13(21)4-7-17(16)24(27)28/h2-8,11H,9-10H2,1H3,(H,22,25) |
| InChIKey | ZJOZOVZQKBOEGK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|