C19H15FN2O5S — CID 46661019
[2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate (PubChem CID 46661019) has the molecular formula C19H15FN2O5S and a molecular weight of 402.40 g/mol. Its IUPAC name is [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate.
| Compound Name | [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate |
|---|---|
| PubChem CID | 46661019 |
| Molecular Formula | C19H15FN2O5S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate |
| SMILES | Cc1cccc([N+](=O)[O-])c1C(=O)OCc1csc(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H15FN2O5S/c1-12-3-2-4-16(22(24)25)18(12)19(23)27-9-14-11-28-17(21-14)10-26-15-7-5-13(20)6-8-15/h2-8,11H,9-10H2,1H3 |
| InChIKey | YWIUKSNFLVEUCA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|