C22H21N3O5S — CID 33353092
[2-(N-acetyl-2,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate (PubChem CID 33353092) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is [2-(N-acetyl-2,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate.
| Compound Name | [2-(N-acetyl-2,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate |
|---|---|
| PubChem CID | 33353092 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [2-(N-acetyl-2,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate |
| SMILES | CC(=O)N(c1nc(COC(=O)c2c(C)cccc2[N+](=O)[O-])cs1)c1ccc(C)cc1C |
| InChI | InChI=1S/C22H21N3O5S/c1-13-8-9-18(15(3)10-13)24(16(4)26)22-23-17(12-31-22)11-30-21(27)20-14(2)6-5-7-19(20)25(28)29/h5-10,12H,11H2,1-4H3 |
| InChIKey | VXOLFKGHFKUONO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|