C19H14FN3O5S — CID 25470926
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-nitrobenzoate (PubChem CID 25470926) has the molecular formula C19H14FN3O5S and a molecular weight of 415.40 g/mol. Its IUPAC name is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-nitrobenzoate.
| Compound Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-nitrobenzoate |
|---|---|
| PubChem CID | 25470926 |
| Molecular Formula | C19H14FN3O5S |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-nitrobenzoate |
| SMILES | CC(=O)N(c1nc(COC(=O)c2ccccc2[N+](=O)[O-])cs1)c1ccccc1F |
| InChI | InChI=1S/C19H14FN3O5S/c1-12(24)22(17-9-5-3-7-15(17)20)19-21-13(11-29-19)10-28-18(25)14-6-2-4-8-16(14)23(26)27/h2-9,11H,10H2,1H3 |
| InChIKey | LNDZGZNBWFMNTL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|