C26H21FN2O3S — CID 42985028
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-benzylbenzoate (PubChem CID 42985028) has the molecular formula C26H21FN2O3S and a molecular weight of 460.53 g/mol. Its IUPAC name is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-benzylbenzoate.
| Compound Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-benzylbenzoate |
|---|---|
| PubChem CID | 42985028 |
| Molecular Formula | C26H21FN2O3S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-benzylbenzoate |
| SMILES | CC(=O)N(c1nc(COC(=O)c2ccccc2Cc2ccccc2)cs1)c1ccccc1F |
| InChI | InChI=1S/C26H21FN2O3S/c1-18(30)29(24-14-8-7-13-23(24)27)26-28-21(17-33-26)16-32-25(31)22-12-6-5-11-20(22)15-19-9-3-2-4-10-19/h2-14,17H,15-16H2,1H3 |
| InChIKey | MFXCEVBGISUXDW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |