C18H15FN2O4S — CID 16960575
2-[(4-fluorophenoxy)methyl]-4-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazole (PubChem CID 16960575) has the molecular formula C18H15FN2O4S and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-4-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-4-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 16960575 |
| Molecular Formula | C18H15FN2O4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-4-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazole |
| SMILES | Cc1ccc(OCc2csc(COc3ccc(F)cc3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15FN2O4S/c1-12-2-7-17(16(8-12)21(22)23)25-9-14-11-26-18(20-14)10-24-15-5-3-13(19)4-6-15/h2-8,11H,9-10H2,1H3 |
| InChIKey | WLENEFYHHKDVNI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|