C14H17N3O3S — CID 61487544
[3-nitro-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]methanamine (PubChem CID 61487544) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is [3-nitro-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]methanamine.
| Compound Name | [3-nitro-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 61487544 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | [3-nitro-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]methanamine |
| SMILES | CCCc1nc(COc2ccc(CN)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C14H17N3O3S/c1-2-3-14-16-11(9-21-14)8-20-13-5-4-10(7-15)6-12(13)17(18)19/h4-6,9H,2-3,7-8,15H2,1H3 |
| InChIKey | MHIZZSXBVOUMPX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|