C24H25N3O5S — CID 55649399
propan-2-yl 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 55649399) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is propan-2-yl 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55649399 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | propan-2-yl 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)Cc1csc(Cc2ccccc2)n1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H25N3O5S/c1-16(2)32-24(29)14-20(19-10-6-7-11-21(19)27(30)31)26-22(28)13-18-15-33-23(25-18)12-17-8-4-3-5-9-17/h3-11,15-16,20H,12-14H2,1-2H3,(H,26,28) |
| InChIKey | WICDJYYARQMRLA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|