C21H21N3O5S2 — CID 46637756
propan-2-yl 3-[(4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbonyl)amino]-3-(2-nitrophenyl)propanoate (PubChem CID 46637756) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is propan-2-yl 3-[(4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbonyl)amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[(4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbonyl)amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 46637756 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | propan-2-yl 3-[(4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbonyl)amino]-3-(2-nitrophenyl)propanoate |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)NC(CC(=O)OC(C)C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21N3O5S2/c1-12(2)29-18(25)10-16(15-6-4-5-7-17(15)24(27)28)23-20(26)19-13(3)22-21(31-19)14-8-9-30-11-14/h4-9,11-12,16H,10H2,1-3H3,(H,23,26) |
| InChIKey | LKGZFOBRYJIHDG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|