C20H23N3O6S — CID 55439881
propan-2-yl 3-[[2-[(5-methylthiophene-2-carbonyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 55439881) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is propan-2-yl 3-[[2-[(5-methylthiophene-2-carbonyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[2-[(5-methylthiophene-2-carbonyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55439881 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | propan-2-yl 3-[[2-[(5-methylthiophene-2-carbonyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | Cc1ccc(C(=O)NCC(=O)NC(CC(=O)OC(C)C)c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C20H23N3O6S/c1-12(2)29-19(25)10-15(14-6-4-5-7-16(14)23(27)28)22-18(24)11-21-20(26)17-9-8-13(3)30-17/h4-9,12,15H,10-11H2,1-3H3,(H,21,26)(H,22,24) |
| InChIKey | QBJYFZSPYPCTGI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|