C21H21F2N3O6 — CID 55494796
propan-2-yl 3-[[2-[(2,4-difluorobenzoyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 55494796) has the molecular formula C21H21F2N3O6 and a molecular weight of 449.41 g/mol. Its IUPAC name is propan-2-yl 3-[[2-[(2,4-difluorobenzoyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[2-[(2,4-difluorobenzoyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55494796 |
| Molecular Formula | C21H21F2N3O6 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | propan-2-yl 3-[[2-[(2,4-difluorobenzoyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CNC(=O)c1ccc(F)cc1F)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21F2N3O6/c1-12(2)32-20(28)10-17(15-5-3-4-6-18(15)26(30)31)25-19(27)11-24-21(29)14-8-7-13(22)9-16(14)23/h3-9,12,17H,10-11H2,1-2H3,(H,24,29)(H,25,27) |
| InChIKey | CRCBQEWZCSYTOR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|