C18H18F2N2O2 — CID 24594478
2,4-difluoro-N-[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 24594478) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24594478 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,4-difluoro-N-[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | Cc1ccccc1C(C)NC(=O)CNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H18F2N2O2/c1-11-5-3-4-6-14(11)12(2)22-17(23)10-21-18(24)15-8-7-13(19)9-16(15)20/h3-9,12H,10H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | KMELUCIPWXSKOU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |