C21H22F2N2O5 — CID 55608305
propan-2-yl 3-[3-(3,4-difluorophenyl)propanoylamino]-3-(2-nitrophenyl)propanoate (PubChem CID 55608305) has the molecular formula C21H22F2N2O5 and a molecular weight of 420.41 g/mol. Its IUPAC name is propan-2-yl 3-[3-(3,4-difluorophenyl)propanoylamino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[3-(3,4-difluorophenyl)propanoylamino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55608305 |
| Molecular Formula | C21H22F2N2O5 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | propan-2-yl 3-[3-(3,4-difluorophenyl)propanoylamino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CCc1ccc(F)c(F)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22F2N2O5/c1-13(2)30-21(27)12-18(15-5-3-4-6-19(15)25(28)29)24-20(26)10-8-14-7-9-16(22)17(23)11-14/h3-7,9,11,13,18H,8,10,12H2,1-2H3,(H,24,26) |
| InChIKey | KBNBVWAJDAVHHC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|