C25H28N4O7 — CID 46578504
propan-2-yl 3-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoylamino]-3-(2-nitrophenyl)propanoate (PubChem CID 46578504) has the molecular formula C25H28N4O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is propan-2-yl 3-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoylamino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoylamino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 46578504 |
| Molecular Formula | C25H28N4O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | propan-2-yl 3-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoylamino]-3-(2-nitrophenyl)propanoate |
| SMILES | CCOc1ccc(-c2noc(CCC(=O)NC(CC(=O)OC(C)C)c3ccccc3[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C25H28N4O7/c1-4-34-18-11-9-17(10-12-18)25-27-23(36-28-25)14-13-22(30)26-20(15-24(31)35-16(2)3)19-7-5-6-8-21(19)29(32)33/h5-12,16,20H,4,13-15H2,1-3H3,(H,26,30) |
| InChIKey | CUTOVEZVCSAEBC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|