C25H27N3O6 — CID 43078085
propan-2-yl 3-(2-nitrophenyl)-3-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]propanoate (PubChem CID 43078085) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is propan-2-yl 3-(2-nitrophenyl)-3-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]propanoate.
| Compound Name | propan-2-yl 3-(2-nitrophenyl)-3-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]propanoate |
|---|---|
| PubChem CID | 43078085 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | propan-2-yl 3-(2-nitrophenyl)-3-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CCCc1ncc(-c2ccccc2)o1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H27N3O6/c1-17(2)33-25(30)15-20(19-11-6-7-12-21(19)28(31)32)27-23(29)13-8-14-24-26-16-22(34-24)18-9-4-3-5-10-18/h3-7,9-12,16-17,20H,8,13-15H2,1-2H3,(H,27,29) |
| InChIKey | LKKWFQUDAUDLPW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|