C22H25FN4O6 — CID 43041640
propan-2-yl 3-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 43041640) has the molecular formula C22H25FN4O6 and a molecular weight of 460.46 g/mol. Its IUPAC name is propan-2-yl 3-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 43041640 |
| Molecular Formula | C22H25FN4O6 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | propan-2-yl 3-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CNC(=O)NCc1ccc(F)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25FN4O6/c1-14(2)33-21(29)11-18(17-5-3-4-6-19(17)27(31)32)26-20(28)13-25-22(30)24-12-15-7-9-16(23)10-8-15/h3-10,14,18H,11-13H2,1-2H3,(H,26,28)(H2,24,25,30) |
| InChIKey | TWFTZYQWOBWLCL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|