C22H26N6O5 — CID 55440331
propan-2-yl 3-[3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoylamino]-3-(2-nitrophenyl)propanoate (PubChem CID 55440331) has the molecular formula C22H26N6O5 and a molecular weight of 454.49 g/mol. Its IUPAC name is propan-2-yl 3-[3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoylamino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoylamino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55440331 |
| Molecular Formula | C22H26N6O5 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | propan-2-yl 3-[3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoylamino]-3-(2-nitrophenyl)propanoate |
| SMILES | Cc1nc2ncnn2c(C)c1CCC(=O)NC(CC(=O)OC(C)C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N6O5/c1-13(2)33-21(30)11-18(17-7-5-6-8-19(17)28(31)32)26-20(29)10-9-16-14(3)25-22-23-12-24-27(22)15(16)4/h5-8,12-13,18H,9-11H2,1-4H3,(H,26,29) |
| InChIKey | ZBBUGWSCEPCZPC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|