C19H23N3O7S2 — CID 46637804
propan-2-yl 3-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 46637804) has the molecular formula C19H23N3O7S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is propan-2-yl 3-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 46637804 |
| Molecular Formula | C19H23N3O7S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | propan-2-yl 3-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CN(C)S(=O)(=O)c1cccs1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23N3O7S2/c1-13(2)29-18(24)11-15(14-7-4-5-8-16(14)22(25)26)20-17(23)12-21(3)31(27,28)19-9-6-10-30-19/h4-10,13,15H,11-12H2,1-3H3,(H,20,23) |
| InChIKey | ACFNKSJIUXRAEO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|