C16H19NO2S — CID 81476230
3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-methylbenzoic acid (PubChem CID 81476230) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-methylbenzoic acid.
| Compound Name | 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 81476230 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C16H19NO2S/c1-10-5-6-11(15(18)19)7-12(10)8-14-17-13(9-20-14)16(2,3)4/h5-7,9H,8H2,1-4H3,(H,18,19) |
| InChIKey | DGWBNJVASCBPPY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |