C24H27N3S — CID 145045272
N-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 145045272) has the molecular formula C24H27N3S and a molecular weight of 389.57 g/mol. Its IUPAC name is N-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 145045272 |
| Molecular Formula | C24H27N3S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | Cc1ccc(-c2csc(Cc3cc(C)c(NC4=NCCCC4)cc3C)n2)cc1 |
| InChI | InChI=1S/C24H27N3S/c1-16-7-9-19(10-8-16)22-15-28-24(27-22)14-20-12-18(3)21(13-17(20)2)26-23-6-4-5-11-25-23/h7-10,12-13,15H,4-6,11,14H2,1-3H3,(H,25,26) |
| InChIKey | YGGXKZOYGVYREO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |