C15H14N2O3S3 — CID 175911363
phenyl-[2-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethyl]sulfamic acid (PubChem CID 175911363) has the molecular formula C15H14N2O3S3 and a molecular weight of 366.49 g/mol. Its IUPAC name is phenyl-[2-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethyl]sulfamic acid.
| Compound Name | phenyl-[2-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethyl]sulfamic acid |
|---|---|
| PubChem CID | 175911363 |
| Molecular Formula | C15H14N2O3S3 |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | phenyl-[2-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethyl]sulfamic acid |
| SMILES | O=S(=O)(O)N(CCc1nc(-c2cccs2)cs1)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O3S3/c18-23(19,20)17(12-5-2-1-3-6-12)9-8-15-16-13(11-22-15)14-7-4-10-21-14/h1-7,10-11H,8-9H2,(H,18,19,20) |
| InChIKey | UHQJCURKVDZAOE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|