C9H8BrNS3 — CID 116965991
2-[4-(4-bromothiophen-2-yl)-1,3-thiazol-2-yl]ethanethiol (PubChem CID 116965991) has the molecular formula C9H8BrNS3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-[4-(4-bromothiophen-2-yl)-1,3-thiazol-2-yl]ethanethiol.
| Compound Name | 2-[4-(4-bromothiophen-2-yl)-1,3-thiazol-2-yl]ethanethiol |
|---|---|
| PubChem CID | 116965991 |
| Molecular Formula | C9H8BrNS3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 304.90 |
| IUPAC Name | 2-[4-(4-bromothiophen-2-yl)-1,3-thiazol-2-yl]ethanethiol |
| SMILES | SCCc1nc(-c2cc(Br)cs2)cs1 |
| InChI | InChI=1S/C9H8BrNS3/c10-6-3-8(13-4-6)7-5-14-9(11-7)1-2-12/h3-5,12H,1-2H2 |
| InChIKey | IKGJMAGFCIBRPS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|