C9H7F3N2S — CID 125457809
5-methyl-3-thiophen-2-yl-4-(trifluoromethyl)-1H-pyrazole (PubChem CID 125457809) has the molecular formula C9H7F3N2S and a molecular weight of 232.23 g/mol. Its IUPAC name is 5-methyl-3-thiophen-2-yl-4-(trifluoromethyl)-1H-pyrazole.
| Compound Name | 5-methyl-3-thiophen-2-yl-4-(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 125457809 |
| Molecular Formula | C9H7F3N2S |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 5-methyl-3-thiophen-2-yl-4-(trifluoromethyl)-1H-pyrazole |
| SMILES | Cc1[nH]nc(-c2cccs2)c1C(F)(F)F |
| InChI | InChI=1S/C9H7F3N2S/c1-5-7(9(10,11)12)8(14-13-5)6-3-2-4-15-6/h2-4H,1H3,(H,13,14) |
| InChIKey | MLLLXSNYKIFXTR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |