C9H13F3N2 — CID 160726622
3-tert-butyl-5-methyl-4-(trifluoromethyl)-1H-pyrazole (PubChem CID 160726622) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 3-tert-butyl-5-methyl-4-(trifluoromethyl)-1H-pyrazole.
| Compound Name | 3-tert-butyl-5-methyl-4-(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 160726622 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 3-tert-butyl-5-methyl-4-(trifluoromethyl)-1H-pyrazole |
| SMILES | Cc1[nH]nc(C(C)(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2/c1-5-6(9(10,11)12)7(14-13-5)8(2,3)4/h1-4H3,(H,13,14) |
| InChIKey | YQLPTWKLYZVRCN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |