C10H17F3N2 — CID 163231919
4-ethyl-5-methyl-3-(trifluoromethyl)-1H-pyrazole;propane (PubChem CID 163231919) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 4-ethyl-5-methyl-3-(trifluoromethyl)-1H-pyrazole;propane.
| Compound Name | 4-ethyl-5-methyl-3-(trifluoromethyl)-1H-pyrazole;propane |
|---|---|
| PubChem CID | 163231919 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 4-ethyl-5-methyl-3-(trifluoromethyl)-1H-pyrazole;propane |
| SMILES | CCC.CCc1c(C(F)(F)F)n[nH]c1C |
| InChI | InChI=1S/C7H9F3N2.C3H8/c1-3-5-4(2)11-12-6(5)7(8,9)10;1-3-2/h3H2,1-2H3,(H,11,12);3H2,1-2H3 |
| InChIKey | VUOWBJILTRBVHV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |