C9H12F3N3 — CID 169473905
N-methyl-3-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-en-1-amine (PubChem CID 169473905) has the molecular formula C9H12F3N3 and a molecular weight of 219.21 g/mol. Its IUPAC name is N-methyl-3-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-en-1-amine.
| Compound Name | N-methyl-3-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 169473905 |
| Molecular Formula | C9H12F3N3 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-methyl-3-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-en-1-amine |
| SMILES | CNCC=Cc1c(C(F)(F)F)n[nH]c1C |
| InChI | InChI=1S/C9H12F3N3/c1-6-7(4-3-5-13-2)8(15-14-6)9(10,11)12/h3-4,13H,5H2,1-2H3,(H,14,15) |
| InChIKey | HXXYLPBDBDIZLM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |