C14H16F2N4 — CID 137216754
(3E)-3-fluoro-4-[1-[3-(1-fluoroethenyl)-4-[(Z)-prop-1-enyl]-1H-pyrazol-5-yl]ethylideneamino]buta-1,3-dien-2-amine (PubChem CID 137216754) has the molecular formula C14H16F2N4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3E)-3-fluoro-4-[1-[3-(1-fluoroethenyl)-4-[(Z)-prop-1-enyl]-1H-pyrazol-5-yl]ethylideneamino]buta-1,3-dien-2-amine.
| Compound Name | (3E)-3-fluoro-4-[1-[3-(1-fluoroethenyl)-4-[(Z)-prop-1-enyl]-1H-pyrazol-5-yl]ethylideneamino]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 137216754 |
| Molecular Formula | C14H16F2N4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (3E)-3-fluoro-4-[1-[3-(1-fluoroethenyl)-4-[(Z)-prop-1-enyl]-1H-pyrazol-5-yl]ethylideneamino]buta-1,3-dien-2-amine |
| SMILES | C=C(N)/C(F)=C\N=C(/C)c1[nH]nc(C(=C)F)c1/C=C\C |
| InChI | InChI=1S/C14H16F2N4/c1-5-6-11-13(8(2)15)19-20-14(11)10(4)18-7-12(16)9(3)17/h5-7H,2-3,17H2,1,4H3,(H,19,20)/b6-5-,12-7+,18-10+ |
| InChIKey | UWZUXXLCGXMWOG-QQJZTWGFSA-N |
| XLogP | 3.48 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|