C11H14FN3 — CID 156792340
N-ethenyl-2-[5-(1-fluoroethyl)-4-methyl-1H-pyrazol-3-yl]prop-2-en-1-imine (PubChem CID 156792340) has the molecular formula C11H14FN3 and a molecular weight of 207.25 g/mol. Its IUPAC name is N-ethenyl-2-[5-(1-fluoroethyl)-4-methyl-1H-pyrazol-3-yl]prop-2-en-1-imine.
| Compound Name | N-ethenyl-2-[5-(1-fluoroethyl)-4-methyl-1H-pyrazol-3-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 156792340 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | N-ethenyl-2-[5-(1-fluoroethyl)-4-methyl-1H-pyrazol-3-yl]prop-2-en-1-imine |
| SMILES | C=C/N=C/C(=C)c1n[nH]c(C(C)F)c1C |
| InChI | InChI=1S/C11H14FN3/c1-5-13-6-7(2)10-8(3)11(9(4)12)15-14-10/h5-6,9H,1-2H2,3-4H3,(H,14,15)/b13-6+ |
| InChIKey | PLXASZQUIXHHIF-AWNIVKPZSA-N |
| XLogP | 2.98 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|