C11H12F3N3 — CID 143061895
(Z)-N-ethenyl-1-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]but-2-en-1-imine (PubChem CID 143061895) has the molecular formula C11H12F3N3 and a molecular weight of 243.23 g/mol. Its IUPAC name is (Z)-N-ethenyl-1-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]but-2-en-1-imine.
| Compound Name | (Z)-N-ethenyl-1-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 143061895 |
| Molecular Formula | C11H12F3N3 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (Z)-N-ethenyl-1-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]but-2-en-1-imine |
| SMILES | C=C/N=C(\C=C/C)c1n[nH]c(C(F)(F)F)c1C |
| InChI | InChI=1S/C11H12F3N3/c1-4-6-8(15-5-2)9-7(3)10(17-16-9)11(12,13)14/h4-6H,2H2,1,3H3,(H,16,17)/b6-4-,15-8+ |
| InChIKey | SYVFLNKLCSAXOC-KKMCOEOTSA-N |
| XLogP | 3.25 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|