C11H13FN2 — CID 156543390
3-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]-5-methyl-1H-pyrazole (PubChem CID 156543390) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]-5-methyl-1H-pyrazole.
| Compound Name | 3-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]-5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 156543390 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]-5-methyl-1H-pyrazole |
| SMILES | C=C/C(=C(F)\C=C/C)c1cc(C)[nH]n1 |
| InChI | InChI=1S/C11H13FN2/c1-4-6-10(12)9(5-2)11-7-8(3)13-14-11/h4-7H,2H2,1,3H3,(H,13,14)/b6-4-,10-9- |
| InChIKey | WCGKJYXUYQZSHE-DRBYQGIJSA-N |
| XLogP | 3.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|