C9H5F11N2 — CID 2776343
5-methyl-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-pyrazole (PubChem CID 2776343) has the molecular formula C9H5F11N2 and a molecular weight of 350.13 g/mol. Its IUPAC name is 5-methyl-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-pyrazole.
| Compound Name | 5-methyl-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-pyrazole |
|---|---|
| PubChem CID | 2776343 |
| Molecular Formula | C9H5F11N2 |
| Molecular Weight | 350.13 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 5-methyl-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-pyrazole |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C9H5F11N2/c1-3-2-4(22-21-3)5(10,11)6(12,13)7(14,15)8(16,17)9(18,19)20/h2H,1H3,(H,21,22) |
| InChIKey | ADTJLQBSULGRRY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.13 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|