C11H15FN3P — CID 126583463
N-[[3-[(1Z)-3-fluorobuta-1,3-dienyl]-4-methyl-1H-pyrazol-5-yl]methyl]phosphiran-1-amine (PubChem CID 126583463) has the molecular formula C11H15FN3P and a molecular weight of 239.23 g/mol. Its IUPAC name is N-[[3-[(1Z)-3-fluorobuta-1,3-dienyl]-4-methyl-1H-pyrazol-5-yl]methyl]phosphiran-1-amine.
| Compound Name | N-[[3-[(1Z)-3-fluorobuta-1,3-dienyl]-4-methyl-1H-pyrazol-5-yl]methyl]phosphiran-1-amine |
|---|---|
| PubChem CID | 126583463 |
| Molecular Formula | C11H15FN3P |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-[[3-[(1Z)-3-fluorobuta-1,3-dienyl]-4-methyl-1H-pyrazol-5-yl]methyl]phosphiran-1-amine |
| SMILES | C=C(F)/C=C\c1n[nH]c(CNP2CC2)c1C |
| InChI | InChI=1S/C11H15FN3P/c1-8(12)3-4-10-9(2)11(15-14-10)7-13-16-5-6-16/h3-4,13H,1,5-7H2,2H3,(H,14,15)/b4-3- |
| InChIKey | PDLQYVSMHIAECY-ARJAWSKDSA-N |
| XLogP | 2.71 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|